cas: 480424-71-3 — see every product listed under this CAS number, including other names
tert-Butyl (2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl) carbonate 98% (CAS 480424-71-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A333604-250mg |
| cas | 480424-71-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 1104.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A333604 |
Tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate (CAS 480424-71-3) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate. InChIKey: JWSZKSKLMRKJHM-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate |
| InChIKey | JWSZKSKLMRKJHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)