cas: 1158767-01-1 — see every product listed under this CAS number, including other names
tert-Butyl (4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate 95% (CAS 1158767-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151398-100mg |
| cas | 1158767-01-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 3435.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A151398 |
Tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate (CAS 1158767-01-1) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate. InChIKey: PMIXNXQUMXCCIK-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate |
| InChIKey | PMIXNXQUMXCCIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC2=C(C1)C=NN2 |
Computed by PubChem (NCBI)