cas: 1158767-01-1 — see every product listed under this CAS number, including other names
tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate, 97%, 97% (CAS 1158767-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104LT-100mg |
| cas | 1158767-01-1 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 530.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate (CAS 1158767-01-1) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate. InChIKey: PMIXNXQUMXCCIK-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate |
| InChIKey | PMIXNXQUMXCCIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC2=C(C1)C=NN2 |
Computed by PubChem (NCBI)