cas: 951884-50-7 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-4-fluorobenzoate 97% (CAS 951884-50-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218482-1g |
| cas | 951884-50-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1405.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A218482 |
Tert-butyl 2-bromo-4-fluorobenzoate (CAS 951884-50-7) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 2-bromo-4-fluorobenzoate. InChIKey: NCGLBILYMNWPMU-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 2-bromo-4-fluorobenzoate |
| InChIKey | NCGLBILYMNWPMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)