cas: 375368-94-8 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-4-fluorobenzoate 97% (CAS 375368-94-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A511752-100mg |
| cas | 375368-94-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A511752 |
Tert-butyl 3-bromo-4-fluorobenzoate (CAS 375368-94-8) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 3-bromo-4-fluorobenzoate. InChIKey: MUGCZCJMBJFCIX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 3-bromo-4-fluorobenzoate |
| InChIKey | MUGCZCJMBJFCIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)