cas: 1018948-99-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-5-formylbenzoate 95+% (CAS 1018948-99-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A251492-250mg |
| cas | 1018948-99-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2033.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A251492 |
Tert-butyl 3-bromo-5-formylbenzoate (CAS 1018948-99-6) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: tert-butyl 3-bromo-5-formylbenzoate. InChIKey: WJYXOHSLYSXYCL-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-formylbenzoate |
| InChIKey | WJYXOHSLYSXYCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)C=O)Br |
Computed by PubChem (NCBI)