cas: 889858-12-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromo-2-fluorobenzoate, 98% (CAS 889858-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318125-1G |
| cas | 889858-12-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 1034.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-bromo-2-fluorobenzoate (CAS 889858-12-2) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 4-bromo-2-fluorobenzoate. InChIKey: ZPGZHSAOCVWZMR-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 4-bromo-2-fluorobenzoate |
| InChIKey | ZPGZHSAOCVWZMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)