cas: 1057961-75-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromo-3-fluorobenzoate 98% (CAS 1057961-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A966112-250mg |
| cas | 1057961-75-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 848.75 Pln | |
| Ambeed | 25g | 2723.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A966112 |
Tert-butyl 4-bromo-3-fluorobenzoate (CAS 1057961-75-7) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 4-bromo-3-fluorobenzoate. InChIKey: KLVOTIIVGDSRRO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-fluorobenzoate |
| InChIKey | KLVOTIIVGDSRRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)