cas: 1057961-75-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromo-3-fluorobenzoate, 98%, 98% (CAS 1057961-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Z3T-250mg |
| cas | 1057961-75-7 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 626.00 Pln | |
| Chemat | 10g | 1053.20 Pln | |
| Chemat | 25g | 1970.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-bromo-3-fluorobenzoate (CAS 1057961-75-7) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 4-bromo-3-fluorobenzoate. InChIKey: KLVOTIIVGDSRRO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-fluorobenzoate |
| InChIKey | KLVOTIIVGDSRRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)