tert-Butyl 4-bromo-3-formylbenzoate, 95%
cas: 1329170-75-3 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromo-3-formylbenzoate, 95% (CAS 1329170-75-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1494905-250mg |
| cas | 1329170-75-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Ambeed | 5g | 3941.50 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1730.53 Pln | |
| BLDpharm | 5g | 4246.31 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1182.80 Pln | |
| Chemat | 5g | 2877.20 Pln | |
| Fluorochem | 100mg | 398.84 Pln | |
| Fluorochem | 250mg | 648.75 Pln | |
| Fluorochem | 1g | 1664.02 Pln | |
| Fluorochem | 5g | 4027.77 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-bromo-3-formylbenzoate (CAS 1329170-75-3) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: tert-butyl 4-bromo-3-formylbenzoate. InChIKey: FSYXQDFLVYJNID-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-formylbenzoate |
| InChIKey | FSYXQDFLVYJNID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)Br)C=O |
Computed by PubChem (NCBI)