CAS 1329170-75-3 appears in our catalog under these names: tert-Butyl 4-bromo-3-formylbenzoate, 95%, tert-Butyl 4-bromo-3-formylbenzoate, 95%, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 4-bromo-3-formylbenzoate (CAS 1329170-75-3) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: tert-butyl 4-bromo-3-formylbenzoate. InChIKey: FSYXQDFLVYJNID-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-formylbenzoate |
| InChIKey | FSYXQDFLVYJNID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)Br)C=O |
Computed by PubChem (NCBI)