cas: 219503-74-9 — see every product listed under this CAS number, including other names
tert-Butyl 6-nitro-1H-indazole-1-carboxylate, 97% (CAS 219503-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F228298-100MG |
| cas | 219503-74-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 768.50 Pln | |
| Fluorochem | 10g | 1257.91 Pln | |
| Fluorochem | 25g | 2429.37 Pln | |
| Fluorochem | 100g | 8026.36 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 948.88 Pln | |
| Ambeed | 25g | 1833.31 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 6-nitroindazole-1-carboxylate (CAS 219503-74-9) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: tert-butyl 6-nitroindazole-1-carboxylate. InChIKey: IDQFCHKQFNYMFE-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | tert-butyl 6-nitroindazole-1-carboxylate |
| InChIKey | IDQFCHKQFNYMFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=CC(=C2)[N+](=O)[O-])C=N1 |
Computed by PubChem (NCBI)