cas: 219503-74-9 — see every product listed under this CAS number, including other names
tert-Butyl 6-nitro-1H-indazole-1-carboxylate, 97% (CAS 219503-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228298-100MG |
| cas | 219503-74-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1195.43 Pln | |
| Fluorochem | 25g | 2330.45 Pln | |
| Fluorochem | 100g | 7943.05 Pln | |
| Fluorochem | 250g | 16679.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 6-nitroindazole-1-carboxylate (CAS 219503-74-9) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: tert-butyl 6-nitroindazole-1-carboxylate. InChIKey: IDQFCHKQFNYMFE-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | tert-butyl 6-nitroindazole-1-carboxylate |
| InChIKey | IDQFCHKQFNYMFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=CC(=C2)[N+](=O)[O-])C=N1 |
Computed by PubChem (NCBI)