cas: 207981-48-4 — see every product listed under this CAS number, including other names
trans-2,3-Difluorocinnamic acid (CAS 207981-48-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004804-1G |
| cas | 207981-48-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1606.74 Pln |
| delivery time | 2-3 weeks |
|---|
3-(2,3-difluorophenyl)prop-2-enoic acid (CAS 207981-48-4) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 3-(2,3-difluorophenyl)prop-2-enoic acid. InChIKey: NVQHKPLMLCHFSU-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 3-(2,3-difluorophenyl)prop-2-enoic acid |
| InChIKey | NVQHKPLMLCHFSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C=CC(=O)O |
Computed by PubChem (NCBI)