CAS 175168-71-5 appears in our catalog under these names: rel-(1R,2R)-2-(2-Fluorophenyl)cyclopropane-1-carboxylic acid, rel-(1R,2R)-2-(2-Fluorophenyl)cyclopropanecarboxylic acid, 98%, 98%, rel-(1S,2S)-2-(2-Fluorophenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
Trans-(1R,2R)-2-(2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 175168-71-5) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: trans-(1R,2R)-2-(2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: OLDXGEXZLWOGJN-JGVFFNPUSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | OLDXGEXZLWOGJN-JGVFFNPUSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)