CAS 189153-10-4 appears in our catalog under these names: Boc-trans-4-aminocyclohexane acetic acid, trans–(N–Boc–4–aminocyclohexyl)acetic Acid, trans-4-(Boc-amino)cyclohexaneacetic acid, 97% , Boc-1,4-trans-ACHA-OH, 2-(trans-4-((tert-Butoxycarbonyl)amino)cyclohexyl)acetic acid, 97%, 97%. Offered by: Biosynth, GLPBio, Thermo Scientific (Alfa Aesar), Iris Biotech, Chemat. Available pack sizes: 100g, 250g, 1g, 5g, 25g, 100mg, 250mg, 10g.
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid (CAS 189153-10-4) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid. InChIKey: IHXBNSUFUFFBRL-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid |
| InChIKey | IHXBNSUFUFFBRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)CC(=O)O |
Computed by PubChem (NCBI)