cas: 5891-45-2 — see every product listed under this CAS number, including other names
z-glu-otbu, 97% (CAS 5891-45-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F045479-5G |
| cas | 5891-45-2 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 211.40 Pln | |
| Fluorochem | 100g | 643.54 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Ambeed | 100g | 565.06 Pln | |
| Ambeed | 500g | 2550.88 Pln | |
| Ambeed | 1kg | 5020.62 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 5891-45-2) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (4S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: VJECGKAFPHEJQS-ZDUSSCGKSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (4S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | VJECGKAFPHEJQS-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)