cas: 67604-48-2 — see every product listed under this CAS number, including other names
(±)-Naringenin, 99.84% (CAS 67604-48-2) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g, 1 g, 50 g, 10mM/1mL, 5 g, 500 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011641-100 g |
| cas | 67604-48-2 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 1731.47 Pln | |
| MedChemExpress | 25 g | 946.63 Pln | |
| MedChemExpress | 1 g | 389.35 Pln | |
| MedChemExpress | 50 g | 1271.71 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 5 g | 524.03 Pln | |
| MedChemExpress | 500 mg | 310.40 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 10 g | 686.57 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.84% |
Naringenin is a trihydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 6 and 4'. It is a member of 4'-hydroxyflavanones and a trihydroxyflavanone.
Source: ChEBI
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | FTVWIRXFELQLPI-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)