Products 1192260-78-8
CAS 1192260-78-8 appears in our catalog under these names: Naringenin-d4, 98%, 98%, Naringenin-d4, 99.88%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 10 mg, 5 mg, 1 mg.
(2S)-5,7-dihydroxy-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-2,3-dihydrochromen-4-one (CAS 1192260-78-8) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 276.28 g/mol. IUPAC name: (2S)-5,7-dihydroxy-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: FTVWIRXFELQLPI-MNZXJJDISA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | (2S)-5,7-dihydroxy-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | FTVWIRXFELQLPI-MNZXJJDISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[C@@H]2CC(=O)C3=C(C=C(C=C3O2)O)O)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)