cas: 791098-94-7 — see every product listed under this CAS number, including other names
(1R)-1-(2,4-DICHLOROPHENYL)ETHAN-1-AMINE HCL, 97% (CAS 791098-94-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F506383-1G |
| cas | 791098-94-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 10g | 1611.95 Pln | |
| Fluorochem | 25g | 3153.07 Pln | |
| Fluorochem | 100g | 10072.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(2,4-dichlorophenyl)ethanamine;hydrochloride (CAS 791098-94-7) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1R)-1-(2,4-dichlorophenyl)ethanamine;hydrochloride. InChIKey: ZMGHOINUDXICQX-NUBCRITNSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1R)-1-(2,4-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | ZMGHOINUDXICQX-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)