CAS 1311317-57-3 is the registry number for 2-(2,5-Dichlorophenyl)ethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(2,5-dichlorophenyl)ethanamine;hydrochloride (CAS 1311317-57-3) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: KJEXAWZJQHBSSZ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | KJEXAWZJQHBSSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CCN)Cl.Cl |
Computed by PubChem (NCBI)