CAS 823790-74-5 appears in our catalog under these names: (S)-1-(3,4-Dichlorophenyl)ethanamine hydrochloride, 95%, (1S)-1-(3,4-Dichlorophenyl)ethanamine Hydrochloride, (S)-1-(3,4-Dichlorophenyl)ethanamine hydrochloride, 98%, 98%, (S)-1-(3,4-Dichlorophenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 100mg.
(1S)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride (CAS 823790-74-5) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride. InChIKey: LTTRKULQEVDRNO-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(3,4-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | LTTRKULQEVDRNO-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)