CAS 39959-66-5 appears in our catalog under these names: Ly 78335, 95%, LY 78335/ 99.3% (existing batch purity), LY 78335, LY 78335 hydrochloride, 97%, 97%, 1-(2,3-Dichlorophenyl)ethanamine (hydrochloride), 99.93%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 2mg, 5mg, 10mg, 25mg, 50mg.
1-(2,3-dichlorophenyl)ethanamine;hydrochloride (CAS 39959-66-5) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)ethanamine;hydrochloride. InChIKey: FQTXPVLCCDQRHY-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | FQTXPVLCCDQRHY-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)