CAS 1788072-43-4 appears in our catalog under these names: [(1S)-1-(3,5-Dichlorophenyl)ethyl]amine hydrochloride, 95%, (S)–1–(3,5–Dichlorophenyl)ethanamine hydrochloride, (S)-1-(3,5-Dichlorophenyl)ethanamine hydrochloride, 98%, 98%, (S)-1-(3,5-Dichlorophenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(1S)-1-(3,5-dichlorophenyl)ethanamine;hydrochloride (CAS 1788072-43-4) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(3,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: YKPAICVWOBWQTG-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(3,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | YKPAICVWOBWQTG-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)