CAS 1391506-72-1 appears in our catalog under these names: (1S)-1-(2,5-Dichlorophenyl)ethan-1-amine hydrochloride, (1S)-1-(2,5-Dichlorophenyl)ethan-1-amine hydrochloride, 95%, (1S)-1-(2,5-dichlorophenyl)ethan-1-amine hydrochloride, 95%, 95%, (1S)-1-(2,5-DICHLOROPHENYL)ETHANAMINE HCL, 95%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 100mg.
(1S)-1-(2,5-dichlorophenyl)ethanamine;hydrochloride (CAS 1391506-72-1) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(2,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: KKWDPZFRLWOVHP-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(2,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | KKWDPZFRLWOVHP-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)