CAS 2408964-22-5 is the registry number for 2,4-Dichloro-n-ethylaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,4-dichloro-N-ethylaniline;hydrochloride (CAS 2408964-22-5) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 2,4-dichloro-N-ethylaniline;hydrochloride. InChIKey: NEXWKJDDLAHJNX-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 2,4-dichloro-N-ethylaniline;hydrochloride |
| InChIKey | NEXWKJDDLAHJNX-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)