CAS 844647-34-3 appears in our catalog under these names: (S)-1-(2,4-Dichlorophenyl)ethanamine hydrochloride, 95%, (S)-1-(2,4-Dichlorophenyl)ethanamine Hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 0,5g, 5g.
(1S)-1-(2,4-dichlorophenyl)ethanamine;hydrochloride (CAS 844647-34-3) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(2,4-dichlorophenyl)ethanamine;hydrochloride. InChIKey: ZMGHOINUDXICQX-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(2,4-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | ZMGHOINUDXICQX-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)