cas: 118628-68-5 — see every product listed under this CAS number, including other names
(1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine, 99% (CAS 118628-68-5) is a chemical reagent available from Chemat. Available pack sizes: 250MG. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 294662500 |
| cas | 118628-68-5 |
| size | 250MG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 250MG | 654.80 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
(1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine (CAS 118628-68-5) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine. InChIKey: BTHYVQUNQHWNLS-HZPDHXFCSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | BTHYVQUNQHWNLS-HZPDHXFCSA-N |
| SMILES | CN[C@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)NC |
Computed by PubChem (NCBI)