cas: 118628-68-5 — see every product listed under this CAS number, including other names
(1R,2R)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANEDIAMINE, 96% (CAS 118628-68-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303038-100MG |
| cas | 118628-68-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 1185.02 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine (CAS 118628-68-5) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine. InChIKey: BTHYVQUNQHWNLS-HZPDHXFCSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | BTHYVQUNQHWNLS-HZPDHXFCSA-N |
| SMILES | CN[C@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)NC |
Computed by PubChem (NCBI)