cas: 220352-36-3 — see every product listed under this CAS number, including other names
(1R,2R)-2-(3,4-difluorophenyl)cyclopropanecarboxylic acid, 97%, 97% (CAS 220352-36-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A5L-100mg |
| cas | 220352-36-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1125.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 220352-36-3) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: CSLVZAGSOJLXCT-NKWVEPMBSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | CSLVZAGSOJLXCT-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)