cas: 220352-36-3 — see every product listed under this CAS number, including other names
Ticagrelor impurity 11, 99.77% (CAS 220352-36-3) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 500 mg, 1 g, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-77964-100 mg |
| cas | 220352-36-3 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 333.62 Pln | |
| MedChemExpress | 500 mg | 816.60 Pln | |
| MedChemExpress | 1 g | 1225.27 Pln | |
| MedChemExpress | 5 g | 2883.18 Pln | |
| MedChemExpress | 250 mg | 551.89 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.77% |
Trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 220352-36-3) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: CSLVZAGSOJLXCT-NKWVEPMBSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | CSLVZAGSOJLXCT-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)