cas: 1391506-72-1 — see every product listed under this CAS number, including other names
(1S)-1-(2,5-DICHLOROPHENYL)ETHANAMINE HCL, 95% (CAS 1391506-72-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F797368-100MG |
| cas | 1391506-72-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1627.57 Pln | |
| Fluorochem | 1g | 3970.49 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(2,5-dichlorophenyl)ethanamine;hydrochloride (CAS 1391506-72-1) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(2,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: KKWDPZFRLWOVHP-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(2,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | KKWDPZFRLWOVHP-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)