Products 1394838-41-5
CAS 1394838-41-5 appears in our catalog under these names: 1-(2,5-Dichlorophenyl)ethan-1-amine hydrochloride, 96%, 96%, 1-(2,5-Dichlorophenyl)ethanamine hydrochloride, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(2,5-dichlorophenyl)ethanamine;hydrochloride (CAS 1394838-41-5) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: KKWDPZFRLWOVHP-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | KKWDPZFRLWOVHP-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)