CAS 2243975-77-9 is the registry number for (4-Fluoro-(1,1'-biphenyl)-2-yl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(5-fluoro-2-phenylphenyl)boronic acid (CAS 2243975-77-9) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: (5-fluoro-2-phenylphenyl)boronic acid. InChIKey: NOZSCCQDEMMVTQ-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | (5-fluoro-2-phenylphenyl)boronic acid |
| InChIKey | NOZSCCQDEMMVTQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)