CAS 159020-61-8 appears in our catalog under these names: 3–(4–FLUOROPHENYL)PHENYLBORONIC ACID, (4'-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 5mg, 1g.
[3-(4-fluorophenyl)phenyl]boronic acid (CAS 159020-61-8) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: [3-(4-fluorophenyl)phenyl]boronic acid. InChIKey: MWIYVSACQNAMRW-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | [3-(4-fluorophenyl)phenyl]boronic acid |
| InChIKey | MWIYVSACQNAMRW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)