Products 1107603-40-6

CAS 1107603-40-6 is the registry number for (3'-Fluoro-[1,1'-biphenyl]-4-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-(3-fluorophenyl)phenyl]boronic acid (CAS 1107603-40-6) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: [4-(3-fluorophenyl)phenyl]boronic acid. InChIKey: PCOUIOZFOMGZKD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BFO2
Molecular weight216.02 g/mol
IUPAC name[4-(3-fluorophenyl)phenyl]boronic acid
InChIKeyPCOUIOZFOMGZKD-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CC(=CC=C2)F)(O)O

Computed by PubChem (NCBI)