Products 1199616-73-3
CAS 1199616-73-3 appears in our catalog under these names: (4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, 98+%, 98+%, (4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, 98+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2-fluoro-5-phenylphenyl)boronic acid (CAS 1199616-73-3) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: (2-fluoro-5-phenylphenyl)boronic acid. InChIKey: FWNPBPIXFRESBL-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | (2-fluoro-5-phenylphenyl)boronic acid |
| InChIKey | FWNPBPIXFRESBL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, (2-fluoro-5-phenylphenyl)boronic acid, {4-fluoro-[1,1'-biphenyl]-3-yl}boronic acid, starbld0017807, Boronic acid, B-(4-fluoro[1,1'-biphenyl]-3-yl)-, (2-fluoro-5-phenyl-phenyl)boronic acid, (4-Fluoro[1,1'-biphenyl]-3-yl)boronic acid, (4-Fluoro-[1,1''-biphenyl]-3-yl)boronic acid, B-(4-Fluoro[1,1a(2)-biphenyl]-3-yl)boronic acid, Boronic acid, B-(4-fluoro[1,1?-biphenyl]-3-yl)-