(2,3-Dibromo-5-nitrophenyl)methanol, 95%
cas: 2092623-72-6 — see every product listed under this CAS number, including other names
(2,3-Dibromo-5-nitrophenyl)methanol, 95% (CAS 2092623-72-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1509311-250mg |
| cas | 2092623-72-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1427.25 Pln | |
| BLDpharm | 100mg | 358.79 Pln | |
| BLDpharm | 250mg | 558.72 Pln | |
| BLDpharm | 1g | 1397.31 Pln | |
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 798.80 Pln | |
| Chemat | 1g | 2046.80 Pln | |
| Fluorochem | 100mg | 903.87 Pln | |
| Fluorochem | 250mg | 1481.79 Pln | |
| Fluorochem | 1g | 3777.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2,3-dibromo-5-nitrophenyl)methanol (CAS 2092623-72-6) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: (2,3-dibromo-5-nitrophenyl)methanol. InChIKey: KUAHCXYPYFIULS-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | (2,3-dibromo-5-nitrophenyl)methanol |
| InChIKey | KUAHCXYPYFIULS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)