CAS 2092623-72-6 appears in our catalog under these names: (2,3-Dibromo-5-nitrophenyl)methanol 95%, (2,3-Dibromo-5-nitrophenyl)methanol, 95%, 95%, (2,3-Dibromo-5-nitrophenyl)methanol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2,3-dibromo-5-nitrophenyl)methanol (CAS 2092623-72-6) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: (2,3-dibromo-5-nitrophenyl)methanol. InChIKey: KUAHCXYPYFIULS-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | (2,3-dibromo-5-nitrophenyl)methanol |
| InChIKey | KUAHCXYPYFIULS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)