Products 2386098-53-7
CAS 2386098-53-7 appears in our catalog under these names: (3,4-Dibromo-5-nitrophenyl)methanol 95%, (3,4-Dibromo-5-nitrophenyl)methanol, 95%, 95%, (3,4-Dibromo-5-nitrophenyl)methanol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g.
(3,4-dibromo-5-nitrophenyl)methanol (CAS 2386098-53-7) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: (3,4-dibromo-5-nitrophenyl)methanol. InChIKey: IEXAHQMBGHJCRQ-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | (3,4-dibromo-5-nitrophenyl)methanol |
| InChIKey | IEXAHQMBGHJCRQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Br)Br)CO |
Computed by PubChem (NCBI)