CAS 860585-41-7 appears in our catalog under these names: 1,5-Dibromo-2-methoxy-4-nitrobenzene, 95%, 1,5-Dibromo-2-methoxy-4-nitrobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,5-dibromo-2-methoxy-4-nitrobenzene (CAS 860585-41-7) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: 1,5-dibromo-2-methoxy-4-nitrobenzene. InChIKey: LLYFTAQHQDLPIT-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | 1,5-dibromo-2-methoxy-4-nitrobenzene |
| InChIKey | LLYFTAQHQDLPIT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])Br)Br |
Computed by PubChem (NCBI)