(2,4,5-Trifluoro-3-methoxyphenyl)boronic acid, 95%
cas: 2936627-28-8 — see every product listed under this CAS number, including other names
(2,4,5-Trifluoro-3-methoxyphenyl)boronic acid, 95% (CAS 2936627-28-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2944449-50mg |
| cas | 2936627-28-8 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 220.19 Pln | |
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1232.56 Pln | |
| Ambeed | 5g | 4130.62 Pln | |
| BLDpharm | 50mg | 231.05 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1325.11 Pln | |
| BLDpharm | 5g | 4446.24 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2,4,5-trifluoro-3-methoxyphenyl)boronic acid (CAS 2936627-28-8) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: (2,4,5-trifluoro-3-methoxyphenyl)boronic acid. InChIKey: LEWHTALSCZXUCB-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | (2,4,5-trifluoro-3-methoxyphenyl)boronic acid |
| InChIKey | LEWHTALSCZXUCB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OC)F)F)(O)O |
Computed by PubChem (NCBI)