Products 2936627-28-8
CAS 2936627-28-8 is the registry number for (2,4,5-Trifluoro-3-methoxyphenyl)boronic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(2,4,5-trifluoro-3-methoxyphenyl)boronic acid (CAS 2936627-28-8) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: (2,4,5-trifluoro-3-methoxyphenyl)boronic acid. InChIKey: LEWHTALSCZXUCB-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | (2,4,5-trifluoro-3-methoxyphenyl)boronic acid |
| InChIKey | LEWHTALSCZXUCB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OC)F)F)(O)O |
Computed by PubChem (NCBI)