(2,4-Difluoro-3-(Methoxycarbonyl)Phenyl)Boronic Acid, 98%, 98%
cas: 1190989-12-8 — see every product listed under this CAS number, including other names
(2,4-Difluoro-3-(Methoxycarbonyl)Phenyl)Boronic Acid, 98%, 98% (CAS 1190989-12-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111I7A-100mg |
| cas | 1190989-12-8 |
| size | 100mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 1533.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,4-difluoro-3-methoxycarbonylphenyl)boronic acid (CAS 1190989-12-8) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid. InChIKey: DAXRETVCZVZSNS-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | DAXRETVCZVZSNS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid, 2,4-Difluoro-3-methoxycarbonylphenylboronic acid, (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid, Benzoic acid, 3-borono-2,6-difluoro-, 1-methyl ester, (2,4-Difluoro-3-methoxycarbonyl-phenyl)boronic acid, [2,4-Difluoro-3-(methoxycarbonyl)phenyl]boronic acid, (2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronicacid, (2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid - [D88724]