CAS 1352813-46-7 appears in our catalog under these names: 2,4-Difluoro-3-(hydroxymethyl)phenylboronic acid, 95+%, 95+%, 2,4-Difluoro-3-(hydroxymethyl)phenylboronic acid, 98%, (2,4-Difluoro-3-(hydroxymethyl)phenyl)boronic acid, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
[2,4-difluoro-3-(hydroxymethyl)phenyl]boronic acid (CAS 1352813-46-7) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: [2,4-difluoro-3-(hydroxymethyl)phenyl]boronic acid. InChIKey: AOTLVFMQQQBEHC-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | [2,4-difluoro-3-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | AOTLVFMQQQBEHC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)CO)F)(O)O |
Computed by PubChem (NCBI)