Products 406482-18-6
CAS 406482-18-6 appears in our catalog under these names: 2,4-Difluoro-3-methoxyphenylboronic acid, 96%, (2,4-Difluoro-3-methoxyphenyl)boronic acid 98%, (2,4-Difluoro-3-methoxyphenyl)boronic acid, 98%, 98%, (2,4-Difluoro-3-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2,4-difluoro-3-methoxyphenyl)boronic acid (CAS 406482-18-6) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,4-difluoro-3-methoxyphenyl)boronic acid. InChIKey: NRIQRAMCXSJILE-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,4-difluoro-3-methoxyphenyl)boronic acid |
| InChIKey | NRIQRAMCXSJILE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC)F)(O)O |
Computed by PubChem (NCBI)