CAS 919355-30-9 appears in our catalog under these names: 3,6-Difluoro-2-methoxyphenylboronic acid, 95%, (3,6–Difluoro–2–methoxyphenyl)boronic acid, 3,6-Difluoro-2-methoxybenzeneboronic acid, (3,6-Difluoro-2-methoxyphenyl)boronic acid 95%, B-(3,6-Difluoro-2-methoxyphenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 2,5g, 10g.
(3,6-difluoro-2-methoxyphenyl)boronic acid (CAS 919355-30-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,6-difluoro-2-methoxyphenyl)boronic acid. InChIKey: AXJIPGDXAIMBDX-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (3,6-difluoro-2-methoxyphenyl)boronic acid |
| InChIKey | AXJIPGDXAIMBDX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)F)F)(O)O |
Computed by PubChem (NCBI)