Products 1395417-65-8

CAS 1395417-65-8 appears in our catalog under these names: 2,4-Difluoro-5-methoxyphenylboronic acid, 98%, 2,4–Difluoro–5–methoxyphenylboronic acid, 2,4-Difluoro-5-methoxyphenylboronic acid 98%, 2,4-Difluoro-5-methoxyphenylboronic acid, 98%, 98%, 2,4-DIFLUORO-5-METHOXYPHENYLBORONIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2,4-difluoro-5-methoxyphenyl)boronic acid (CAS 1395417-65-8) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,4-difluoro-5-methoxyphenyl)boronic acid. InChIKey: LPDXDGZARPKGCF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BF2O3
Molecular weight187.94 g/mol
IUPAC name(2,4-difluoro-5-methoxyphenyl)boronic acid
InChIKeyLPDXDGZARPKGCF-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)F)OC)(O)O

Computed by PubChem (NCBI)