Products 870779-02-5
CAS 870779-02-5 appears in our catalog under these names: 2,6-Difluoro-3-methoxyphenylboronic acid, 98%, 2,6–Difluoro–3–methoxyphenylboronic acid(Contains varying amounts of anhydride), 2,6-Difluoro-3-methoxyphenylboronic Acid (contains varying amounts of Anhydride), 2,6-Difluoro-3-methoxyphenylboronic acid 98%, 2,6-Difluoro-3-methoxyphenylboronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250mg.
(2,6-difluoro-3-methoxyphenyl)boronic acid (CAS 870779-02-5) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,6-difluoro-3-methoxyphenyl)boronic acid. InChIKey: WSRQWTCBDHWVGY-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,6-difluoro-3-methoxyphenyl)boronic acid |
| InChIKey | WSRQWTCBDHWVGY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-difluoro-3-methoxybenzeneboronic acid, 2,6-Difluoro-3-methoxyphenylboronic acid, (2,6-difluoro-3-methoxyphenyl)boronic acid, (2,6-difluoro-3-methoxy-phenyl)boronic Acid, 2,6-Difluoro-3-methoxyphenylboronicacid, 2,6-difluoro-3-methoxy-phenylboronic acid, 2,6-Difluoro-3-methoxyphenylboronic acid, >=95%, 2,6-Difluoro-5-methoxyphenylboronic acid, 2,6-Difluoro-3-methoxyphenylboronic acid(Contains varying amounts of anhydride), WSRQWTCBDHWVGY-UHFFFAOYSA-N