Products 208641-98-9

CAS 208641-98-9 appears in our catalog under these names: 3,5-Difluoro-4-methoxyphenylboronic acid, 98%, (3,5-Difluoro-4-methoxyphenyl)boronic acid, 95-<97%, (3,5-Difluoro-4-methoxyphenyl)boronic acid, ≥97-<99%, 3,5–Difluoro–4–methoxyphenylboronic acid, (3,5-Difluoro-4-methoxyphenyl)boronic acid 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 50g, 100g, 200g.

Structural formula: {0} (CAS {1})

(3,5-difluoro-4-methoxyphenyl)boronic acid (CAS 208641-98-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,5-difluoro-4-methoxyphenyl)boronic acid. InChIKey: JJRIEFCRGWHLES-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BF2O3
Molecular weight187.94 g/mol
IUPAC name(3,5-difluoro-4-methoxyphenyl)boronic acid
InChIKeyJJRIEFCRGWHLES-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)F)OC)F)(O)O

Computed by PubChem (NCBI)