Products 897958-93-9
CAS 897958-93-9 appears in our catalog under these names: 2,5-Difluoro-4-methoxyphenylboronic acid, 98%, 2,5-Difluoro-4-methoxyphenylboronic Acid, (2,5-Difluoro-4-methoxyphenyl)boronic acid 95%, (2,5-Difluoro-4-methoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, TRC, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 100g, 250mg, 10g, 25g.
(2,5-difluoro-4-methoxyphenyl)boronic acid (CAS 897958-93-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,5-difluoro-4-methoxyphenyl)boronic acid. InChIKey: BRMUXDWCSVTVPQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,5-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | BRMUXDWCSVTVPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Difluoro-4-methoxyphenylboronic acid, (2,5-difluoro-4-methoxyphenyl)boronic acid, (2,5-difluoro-4-methoxy-phenyl)boronic Acid, (2,5-difluoro-4-methoxyphenyl)boronicacid, [2,5-difluoro-4-(methyloxy)phenyl]boronic acid, 2,5-Difluoro-4-methoxyphenylboronic acid(contains varying amounts of anhydride)